Difference between revisions of "Trans-D3-cis-D9-hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...")
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-METHYLTHIOADENOSINE ==
+
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
 
* common-name:
 
* common-name:
** s-methyl-5'-thioadenosine
+
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
 
* smiles:
 
* smiles:
** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** wuugfsxjnotrmr-ioslpcccsa-n
+
** htjxtkbiuvfuar-xhibxcghsa-j
 
* molecular-weight:
 
* molecular-weight:
** 297.331
+
** 597.259
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[M5TAP]]
+
* [[RXN0-302]]
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
 
* [[RXN-11190]]
 
* [[SPERMIDINESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.4.1.14-RXN]]
+
* [[2.7.1.148-RXN]]
* [[APAPT]]
 
* [[RXN-11190]]
 
* [[RXN-11371]]
 
* [[RXN-14518]]
 
* [[RXN0-5217]]
 
* [[SPERMIDINESYN-RXN]]
 
* [[SPERMINE-SYNTHASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-methyl-5'-thioadenosine}}
+
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
{{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}}
+
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
{{#set: molecular-weight=297.331}}
+
{{#set: molecular-weight=597.259}}

Revision as of 11:16, 15 January 2021

Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET

  • common-name:
    • 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • smiles:
    • cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
  • inchi-key:
    • htjxtkbiuvfuar-xhibxcghsa-j
  • molecular-weight:
    • 597.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality