Difference between revisions of "Trans-D3-cis-D9-hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
+
== Metabolite CPD-12115 ==
 
* common-name:
 
* common-name:
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** demethylmenaquinol-8
 
* smiles:
 
* smiles:
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
 
* inchi-key:
 
* inchi-key:
** htjxtkbiuvfuar-xhibxcghsa-j
+
** fgypgicsxjekcg-aendiincsa-n
 
* molecular-weight:
 
* molecular-weight:
** 597.259
+
** 705.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-302]]
+
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.148-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=demethylmenaquinol-8}}
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
+
{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
{{#set: molecular-weight=597.259}}
+
{{#set: molecular-weight=705.118}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-12115

  • common-name:
    • demethylmenaquinol-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
  • inchi-key:
    • fgypgicsxjekcg-aendiincsa-n
  • molecular-weight:
    • 705.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality