Difference between revisions of "Trans-D3-cis-D9-hexadecenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...")
(Created page with "Category:metabolite == Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs == * common-name: ** a trans-δ3-cis-δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12115 ==
+
== Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-8
+
** a trans-δ3-cis-δ9-hexadecenoyl-[acp]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
 
* inchi-key:
 
** fgypgicsxjekcg-aendiincsa-n
 
* molecular-weight:
 
** 705.118
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+
* [[RXN-10661]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10660]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-8}}
+
{{#set: common-name=a trans-δ3-cis-δ9-hexadecenoyl-[acp]}}
{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
 
{{#set: molecular-weight=705.118}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Trans-D3-cis-D9-hexadecenoyl-ACPs

  • common-name:
    • a trans-δ3-cis-δ9-hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a trans-δ3-cis-δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.