Difference between revisions of "Trans-D3-cis-D9-hexadecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-L-arabinosides == * common-name: ** an oligosaccharide with β-l-arabinopyranose at the non-reducing end == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite 5-METHYLTHIOADENOSINE == * common-name: ** s-methyl-5'-thioadenosine * smiles: ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) * inchi-ke...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-METHYLTHIOADENOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** s-methyl-5'-thioadenosine |
+ | * smiles: | ||
+ | ** cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23))) | ||
+ | * inchi-key: | ||
+ | ** wuugfsxjnotrmr-ioslpcccsa-n | ||
+ | * molecular-weight: | ||
+ | ** 297.331 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[M5TAP]] |
+ | * [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]] | ||
+ | * [[RXN-11190]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[4.4.1.14-RXN]] | ||
+ | * [[APAPT]] | ||
+ | * [[RXN-11190]] | ||
+ | * [[RXN-11371]] | ||
+ | * [[RXN-14518]] | ||
+ | * [[RXN0-5217]] | ||
+ | * [[SPERMIDINESYN-RXN]] | ||
+ | * [[SPERMINE-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=s-methyl-5'-thioadenosine}} |
+ | {{#set: inchi-key=inchikey=wuugfsxjnotrmr-ioslpcccsa-n}} | ||
+ | {{#set: molecular-weight=297.331}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite 5-METHYLTHIOADENOSINE
- common-name:
- s-methyl-5'-thioadenosine
- smiles:
- cscc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
- inchi-key:
- wuugfsxjnotrmr-ioslpcccsa-n
- molecular-weight:
- 297.331