Difference between revisions of "Trans-delta2-behenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-AMINOPHENOL == * common-name: ** 2-aminophenol * smiles: ** c1(c=c(n)c(=cc=1)o) * inchi-key: ** cdawcloxvubkrw-uhfffaoysa-n * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-591 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyanidin |
* smiles: | * smiles: | ||
| − | ** c1(c=c( | + | ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vevzsmaejfvwil-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 285.232 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-9725]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyanidin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.232}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD-591
- common-name:
- cyanidin
- smiles:
- c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
- inchi-key:
- vevzsmaejfvwil-uhfffaoysa-m
- molecular-weight:
- 285.232
