Difference between revisions of "Triacylglycerides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
(Created page with "Category:metabolite == Metabolite Triacylglycerides == * common-name: ** a triglyceride == Reaction(s) known to consume the compound == * TRIACYLGLYCEROL-LIPASE-RXN ==...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Triacylglycerides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a triglyceride |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a triglyceride}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Triacylglycerides
- common-name:
- a triglyceride
