Difference between revisions of "Triacylglycerides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SUC-COA == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite Triacylglycerides == * common-name: ** a triglyceride == Reaction(s) known to consume the compound == * TRIACYLGLYCEROL-LIPASE-RXN ==...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SUC-COA ==
+
== Metabolite Triacylglycerides ==
 
* common-name:
 
* common-name:
** succinyl-coa
+
** a triglyceride
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vnoyujkhfwywir-itiydsspsa-i
 
* molecular-weight:
 
** 862.568
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
* [[HOMSUCTRAN-RXN]]
 
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2OXOGLUTARATEDEH-RXN]]
 
* [[AKGDHe2r]]
 
* [[RXN0-1147]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=succinyl-coa}}
+
{{#set: common-name=a triglyceride}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
 
{{#set: molecular-weight=862.568}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Triacylglycerides

  • common-name:
    • a triglyceride

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality