Difference between revisions of "Triacylglycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC-6-P == * common-name: ** β-d-glucose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o * inchi-key: ** nbschqhzls...") |
(Created page with "Category:metabolite == Metabolite Malonyl-acp-methyl-ester == * common-name: ** a malonyl-[acp] methyl ester == Reaction(s) known to consume the compound == * [[RXN-11474]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Malonyl-acp-methyl-ester == |
* common-name: | * common-name: | ||
| − | ** | + | ** a malonyl-[acp] methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11474]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11475]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a malonyl-[acp] methyl ester}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Malonyl-acp-methyl-ester
- common-name:
- a malonyl-[acp] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a malonyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
