Difference between revisions of "Triacylglycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...") |
(Created page with "Category:metabolite == Metabolite Triacylglycerols == * common-name: ** a triacyl-sn-glycerol == Reaction(s) known to consume the compound == == Reaction(s) known to produ...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Triacylglycerols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a triacyl-sn-glycerol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a triacyl-sn-glycerol}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Triacylglycerols
- common-name:
- a triacyl-sn-glycerol
