Difference between revisions of "Triacylglycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHENYLETHYLAMINE == * common-name: ** 2-phenylethylamine * smiles: ** c([n+])cc1(=cc=cc=c1) * inchi-key: ** bhhgxplmpwcghp-uhfffaoysa-o *...") |
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-61 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** (2r,3s)-2,3-dimethylmalate |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wtiiulqjlzehgz-cvyqjglwsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 160.126 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[23-DIMETHYLMALATE-LYASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=(2r,3s)-2,3-dimethylmalate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=160.126}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-61
- common-name:
- (2r,3s)-2,3-dimethylmalate
- smiles:
- cc(c(=o)[o-])c(c)(o)c(=o)[o-]
- inchi-key:
- wtiiulqjlzehgz-cvyqjglwsa-l
- molecular-weight:
- 160.126
