Difference between revisions of "Tubulin-Heterodimers"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-22766 == == Reaction(s) known to consume the compound == * RXN21167 == Reaction(s) known to produce the compound == * [[RXN21166]...")
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * smiles: ** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-22766 ==
+
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
 +
* common-name:
 +
** udp-n-acetyl-α-d-glucosamine
 +
* smiles:
 +
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
 +
* inchi-key:
 +
** lftytuazoprmmi-cfrasdgpsa-l
 +
* molecular-weight:
 +
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN21167]]
+
* [[2.4.1.101-RXN]]
 +
* [[2.4.1.141-RXN]]
 +
* [[2.4.1.145-RXN]]
 +
* [[2.4.1.155-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.7.8.15-RXN]]
 +
* [[2.7.8.17-RXN]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-15205]]
 +
* [[RXN-6501]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN21166]]
+
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
 +
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
 +
{{#set: molecular-weight=605.342}}

Revision as of 18:56, 14 January 2021

Metabolite UDP-N-ACETYL-D-GLUCOSAMINE

  • common-name:
    • udp-n-acetyl-α-d-glucosamine
  • smiles:
    • cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
  • inchi-key:
    • lftytuazoprmmi-cfrasdgpsa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality