Difference between revisions of "TusE-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
(Created page with "Category:metabolite == Metabolite TusE-L-cysteine == * common-name: ** a [tuse sulfur carrier protein]-l-cysteine == Reaction(s) known to consume the compound == == Reacti...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4822 ==
+
== Metabolite TusE-L-cysteine ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** a [tuse sulfur carrier protein]-l-cysteine
* smiles:
 
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
* inchi-key:
 
** skklouvuunmcje-fqsmhnglsa-s
 
* molecular-weight:
 
** 488.557
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
 
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=a [tuse sulfur carrier protein]-l-cysteine}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
 
{{#set: molecular-weight=488.557}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite TusE-L-cysteine

  • common-name:
    • a [tuse sulfur carrier protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.