Difference between revisions of "TusE-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH3-MALONATE-S-ALD == * common-name: ** (s)-methylmalonate-semialdehyde * smiles: ** cc([ch]=o)c(=o)[o-] * inchi-key: ** vokumxabrrxhar-v...") |
(Created page with "Category:metabolite == Metabolite CPD-397 == * common-name: ** s-methyl-l-methionine * smiles: ** c[s+](ccc([n+])c(=o)[o-])c * inchi-key: ** ydbyjhtyshbbau-yfkpbyrvsa-o *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-397 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-methyl-l-methionine |
* smiles: | * smiles: | ||
| − | ** | + | ** c[s+](ccc([n+])c(=o)[o-])c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ydbyjhtyshbbau-yfkpbyrvsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.242 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[MMUM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-methyl-l-methionine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ydbyjhtyshbbau-yfkpbyrvsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.242}} |
Revision as of 15:27, 5 January 2021
Contents
Metabolite CPD-397
- common-name:
- s-methyl-l-methionine
- smiles:
- c[s+](ccc([n+])c(=o)[o-])c
- inchi-key:
- ydbyjhtyshbbau-yfkpbyrvsa-o
- molecular-weight:
- 164.242
