Difference between revisions of "TusE-S-sulfanylcysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE == * common-name: ** 1d-myo-inositol 1-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o...")
(Created page with "Category:metabolite == Metabolite ACETYLSERINE == * common-name: ** o-acetyl-l-serine * smiles: ** cc(occ([n+])c(=o)[o-])=o * inchi-key: ** vzxpdpzarilfqx-bypyzucnsa-n * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-MYO-INOSITOL-1-MONOPHOSPHATE ==
+
== Metabolite ACETYLSERINE ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 1-monophosphate
+
** o-acetyl-l-serine
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(o)c(o)1)
+
** cc(occ([n+])c(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-uotptpdrsa-l
+
** vzxpdpzarilfqx-bypyzucnsa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 147.13
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16261]]
+
* [[ACSERLY-RXN]]
* [[RXN0-5408]]
+
* [[RXN-12726]]
 +
* [[SULFOCYS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16261]]
+
* [[ACSERLY-RXN]]
 +
* [[SERINE-O-ACETTRAN-RXN]]
 +
* [[SULFOCYS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 1-monophosphate}}
+
{{#set: common-name=o-acetyl-l-serine}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-uotptpdrsa-l}}
+
{{#set: inchi-key=inchikey=vzxpdpzarilfqx-bypyzucnsa-n}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=147.13}}

Revision as of 08:27, 15 March 2021

Metabolite ACETYLSERINE

  • common-name:
    • o-acetyl-l-serine
  • smiles:
    • cc(occ([n+])c(=o)[o-])=o
  • inchi-key:
    • vzxpdpzarilfqx-bypyzucnsa-n
  • molecular-weight:
    • 147.13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality