Difference between revisions of "TusE-S-sulfanylcysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TusE-S-sulfanylcysteine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [tuse sulfur carrier protein]-s-sulfanylcysteine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-2023]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [tuse sulfur carrier protein]-s-sulfanylcysteine}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite TusE-S-sulfanylcysteine
- common-name:
- a [tuse sulfur carrier protein]-s-sulfanylcysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-s-sulfanylcysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
