Difference between revisions of "TusE-S-sulfanylcysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9096 == * common-name: ** bacteriopheophytin a * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cc...")
(Created page with "Category:metabolite == Metabolite TusE-S-sulfanylcysteine == * common-name: ** a [tuse sulfur carrier protein]-s-sulfanylcysteine == Reaction(s) known to consume the compo...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9096 ==
+
== Metabolite TusE-S-sulfanylcysteine ==
 
* common-name:
 
* common-name:
** bacteriopheophytin a
+
** a [tuse sulfur carrier protein]-s-sulfanylcysteine
* smiles:
 
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)cccc(c)cccc(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
 
* inchi-key:
 
** qgudpqyomulita-zasykxldsa-n
 
* molecular-weight:
 
** 888.221
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-2023]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17427]]
 
* [[RXN-8796]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=bacteriopheophytin a}}
+
{{#set: common-name=a [tuse sulfur carrier protein]-s-sulfanylcysteine}}
{{#set: inchi-key=inchikey=qgudpqyomulita-zasykxldsa-n}}
 
{{#set: molecular-weight=888.221}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite TusE-S-sulfanylcysteine

  • common-name:
    • a [tuse sulfur carrier protein]-s-sulfanylcysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [tuse sulfur carrier protein]-s-sulfanylcysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.