Difference between revisions of "TusE-S-sulfanylcysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...")
(Created page with "Category:metabolite == Metabolite CPD-7005 == * common-name: ** geranylgeranyl chlorophyll a * smiles: ** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MANNOSE-1P ==
+
== Metabolite CPD-7005 ==
 
* common-name:
 
* common-name:
** α-d-mannose 1-phosphate
+
** geranylgeranyl chlorophyll a
 
* smiles:
 
* smiles:
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
 
* inchi-key:
 
* inchi-key:
** hxxfsfrbohsimq-rwopyejcsa-l
+
** qblsepresqjtci-znlwzyposa-m
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 886.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[RXN-17428]]
* [[PHOSMANMUT-RXN]]
+
* [[RXN-7664]]
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
* [[RXN4FS-12]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[RXN-7663]]
* [[PHOSMANMUT-RXN]]
 
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-mannose 1-phosphate}}
+
{{#set: common-name=geranylgeranyl chlorophyll a}}
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}}
+
{{#set: inchi-key=inchikey=qblsepresqjtci-znlwzyposa-m}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=886.447}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-7005

  • common-name:
    • geranylgeranyl chlorophyll a
  • smiles:
    • c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
  • inchi-key:
    • qblsepresqjtci-znlwzyposa-m
  • molecular-weight:
    • 886.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality