Difference between revisions of "Type-1-transmemberane-domains"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-8608 == * common-name: ** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c=o)(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8608 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c)cccc([ch]4(c1(c)(c(c=o)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mkmlaqlnfvfnrk-puxrvuthsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 442.724 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-13]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-12]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mkmlaqlnfvfnrk-puxrvuthsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=442.724}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite CPD-8608
- common-name:
- 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
- smiles:
- cc(c)cccc([ch]4(c1(c)(c(c=o)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
- inchi-key:
- mkmlaqlnfvfnrk-puxrvuthsa-n
- molecular-weight:
- 442.724
