Difference between revisions of "Type-1-transmemberane-domains"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite E-PHENYLITACONYL-COA == * common-name: ** (e)-2-benzylidenesuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=...")
(Created page with "Category:metabolite == Metabolite Type-1-transmemberane-domains == * common-name: ** type-1 transmembrane proteins == Reaction(s) known to consume the compound == * 3.4....")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite E-PHENYLITACONYL-COA ==
+
== Metabolite Type-1-transmemberane-domains ==
 
* common-name:
 
* common-name:
** (e)-2-benzylidenesuccinyl-coa
+
** type-1 transmembrane proteins
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** cizckpngzpendv-umuuvtgisa-i
 
* molecular-weight:
 
** 950.677
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-902]]
+
* [[3.4.21.105-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
+
{{#set: common-name=type-1 transmembrane proteins}}
{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
 
{{#set: molecular-weight=950.677}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Type-1-transmemberane-domains

  • common-name:
    • type-1 transmembrane proteins

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality