Difference between revisions of "Type-1-transmemberane-domains"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite E-PHENYLITACONYL-COA == * common-name: ** (e)-2-benzylidenesuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=...") |
(Created page with "Category:metabolite == Metabolite CPD-19490 == * common-name: ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate * smiles: ** csccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** x...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19490 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** csccccc(c(=o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xxjzwlkrfpcklb-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 232.251 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-18206]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18206]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xxjzwlkrfpcklb-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=232.251}} |
Revision as of 15:28, 5 January 2021
Contents
Metabolite CPD-19490
- common-name:
- 3-isopropyl-7-(methylthio)-2-oxoheptanoate
- smiles:
- csccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- xxjzwlkrfpcklb-uhfffaoysa-l
- molecular-weight:
- 232.251
