Difference between revisions of "Type-1-transmemberane-domains"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19490 == * common-name: ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate * smiles: ** csccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** x...") |
(Created page with "Category:metabolite == Metabolite CPD-204 == * common-name: ** gibberellin a8 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-204 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a8 |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wzrrjzyygoohrc-axlmtqbosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 363.386 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-115]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a8}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wzrrjzyygoohrc-axlmtqbosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=363.386}} |
Revision as of 13:11, 14 January 2021
Contents
Metabolite CPD-204
- common-name:
- gibberellin a8
- smiles:
- c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
- inchi-key:
- wzrrjzyygoohrc-axlmtqbosa-m
- molecular-weight:
- 363.386
