Difference between revisions of "UBIQUINOL-30"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44. RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-41...") |
(Created page with "Category:metabolite == Metabolite UBIQUINOL-30 == * common-name: ** ubiquinol-6 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UBIQUINOL-30 == |
| − | * | + | * common-name: |
| − | ** | + | ** ubiquinol-6 |
| − | == | + | * smiles: |
| − | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o) | |
| − | == | + | * inchi-key: |
| − | == | + | ** dyoscpiqeyrqeo-lphqiwjtsa-n |
| − | + | * molecular-weight: | |
| − | * | + | ** 592.901 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN3O-102]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=ubiquinol-6}} |
| − | + | {{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}} | |
| − | + | {{#set: molecular-weight=592.901}} | |
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite UBIQUINOL-30
- common-name:
- ubiquinol-6
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
- inchi-key:
- dyoscpiqeyrqeo-lphqiwjtsa-n
- molecular-weight:
- 592.901
