Difference between revisions of "UBIQUINONE-8"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-adenine-2503 == * common-name: ** adenine2503 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11586 == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13667 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 11-oxo-β-amyrin |
| + | * smiles: | ||
| + | ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c | ||
| + | * inchi-key: | ||
| + | ** ukaiybgrlwqhdq-vcuiepqisa-n | ||
| + | * molecular-weight: | ||
| + | ** 440.708 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13492]] |
| + | * [[RXN-13506]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=11-oxo-β-amyrin}} |
| + | {{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}} | ||
| + | {{#set: molecular-weight=440.708}} | ||
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-13667
- common-name:
- 11-oxo-β-amyrin
- smiles:
- cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
- inchi-key:
- ukaiybgrlwqhdq-vcuiepqisa-n
- molecular-weight:
- 440.708
