Difference between revisions of "UBIQUINONE-8"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15066 RXN-15066] == * direction: ** reversible * common-name: ** acyl-coa:lyso-phosphatidylchol...")
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15066 RXN-15066] ==
+
== Metabolite UBIQUINONE-8 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** acyl-coa:lyso-phosphatidylcholine acyltransferase
+
** ubiquinone-8
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 ec-2.3.1.23]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8343]][c] '''+''' 1 [[PALMITYL-COA]][c] '''<=>''' 1 [[1-2-DIPALMITOYLPHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[CO-A]][c]
+
** icfizjqgjajrsu-sghxuwjisa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09127]]
+
** 727.121
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[R00281]]
−
* Gene: [[SJ13643]]
+
* [[SUCDH_LPAREN_q8_RPAREN_m]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[R00281]]
−
* Gene: [[SJ22477]]
+
* [[SUCDH_LPAREN_q8_RPAREN_m]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=ubiquinone-8}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}}
−
* [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416]
+
{{#set: molecular-weight=727.121}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=acyl-coa:lyso-phosphatidylcholine acyltransferase}}
 
−
{{#set: ec-number=ec-2.3.1.23}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite UBIQUINONE-8

  • common-name:
    • ubiquinone-8
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
  • inchi-key:
    • icfizjqgjajrsu-sghxuwjisa-n
  • molecular-weight:
    • 727.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UBIQUINONE-8&oldid=139256"