Difference between revisions of "UBIQUINONE-8"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMINASE-RXN THIAMINASE-RXN] == * direction: ** left-to-right * common-name: ** thiaminase * ec-n...") |
(Created page with "Category:metabolite == Metabolite UBIQUINONE-8 == * common-name: ** ubiquinone-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UBIQUINONE-8 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** ubiquinone-8 |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o) |
| − | == | + | * inchi-key: |
| − | + | ** icfizjqgjajrsu-sghxuwjisa-n | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 727.121 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[R00281]] |
| − | == | + | * [[SUCDH_LPAREN_q8_RPAREN_m]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[R00281]] | |
| − | == | + | * [[SUCDH_LPAREN_q8_RPAREN_m]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=ubiquinone-8}} |
| − | + | {{#set: inchi-key=inchikey=icfizjqgjajrsu-sghxuwjisa-n}} | |
| − | + | {{#set: molecular-weight=727.121}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite UBIQUINONE-8
- common-name:
- ubiquinone-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c(oc)=c(oc)c(=o)c(c)=1)=o)
- inchi-key:
- icfizjqgjajrsu-sghxuwjisa-n
- molecular-weight:
- 727.121
