Difference between revisions of "UDP-D-GALACTURONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23)...")
(Created page with "Category:metabolite == Metabolite UDP-D-GALACTURONATE == * common-name: ** udp-α-d-galacturonate * smiles: ** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12016 ==
+
== Metabolite UDP-D-GALACTURONATE ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin glucuronide
+
** udp-α-d-galacturonate
 
* smiles:
 
* smiles:
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
+
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
 
* inchi-key:
 
* inchi-key:
** drkqfnyksnwotc-rngzqalnsa-m
+
** hdyanyhvcapmjv-gxnrkqdosa-k
 
* molecular-weight:
 
* molecular-weight:
** 393.372
+
** 577.265
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
+
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin glucuronide}}
+
{{#set: common-name=udp-α-d-galacturonate}}
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
+
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-gxnrkqdosa-k}}
{{#set: molecular-weight=393.372}}
+
{{#set: molecular-weight=577.265}}

Latest revision as of 11:14, 18 March 2021

Metabolite UDP-D-GALACTURONATE

  • common-name:
    • udp-α-d-galacturonate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
  • inchi-key:
    • hdyanyhvcapmjv-gxnrkqdosa-k
  • molecular-weight:
    • 577.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality