Difference between revisions of "UDP-D-XYLOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14483 == * common-name: ** glycyrrhetinate * smiles: ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc(c([o-])=o)(c)cc5...") |
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * smiles: ** cc1(co)(op(=o)([o-])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sfrqrnjmiiuydi-uhnvwzdzsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 276.076 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[HDS]] | ||
| + | * [[RXN-15878]] | ||
| + | * [[RXN0-882]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HDS]] |
| − | * [[ | + | * [[RXN0-302]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=276.076}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE
- common-name:
- 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
- smiles:
- cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
- inchi-key:
- sfrqrnjmiiuydi-uhnvwzdzsa-l
- molecular-weight:
- 276.076
