Difference between revisions of "UDP-D-XYLOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CH33ADO == * common-name: ** 5'-deoxyadenosine * smiles: ** cc1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** xgyimtfotbmpfp-kqy...") |
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UDP-D-XYLOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** udp-α-d-xylose |
* smiles: | * smiles: | ||
− | ** | + | ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dqqdlyvhotzlor-ocimbmbzsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 534.263 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.4.2.26-RXN]] | ||
+ | * [[2.4.2.38-RXN]] | ||
+ | * [[2.7.7.11-RXN]] | ||
+ | * [[RXN-9104]] | ||
+ | * [[UA4E]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[2. | + | * [[2.7.7.11-RXN]] |
− | * [[ | + | * [[UA4E]] |
− | + | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]] | |
− | + | * [[UGDC]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=udp-α-d-xylose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=534.263}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite UDP-D-XYLOSE
- common-name:
- udp-α-d-xylose
- smiles:
- c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
- inchi-key:
- dqqdlyvhotzlor-ocimbmbzsa-l
- molecular-weight:
- 534.263