Difference between revisions of "UDP-D-XYLOSE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05818 R05818] == * direction: ** reversible * common-name: ** 1516-dihydrobiliverdin:ferredoxin ox...") |
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UDP-D-XYLOSE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** udp-α-d-xylose |
| − | = | + | * smiles: |
| − | + | ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3) | |
| − | == | + | * inchi-key: |
| − | * | + | ** dqqdlyvhotzlor-ocimbmbzsa-l |
| − | ** | + | * molecular-weight: |
| − | * | + | ** 534.263 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[2.4.2.26-RXN]] | |
| − | * | + | * [[2.4.2.38-RXN]] |
| − | == | + | * [[2.7.7.11-RXN]] |
| − | + | * [[RXN-9104]] | |
| − | {{#set: common-name= | + | * [[UA4E]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2.7.7.11-RXN]] | |
| − | {{#set: | + | * [[UA4E]] |
| − | + | * [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]] | |
| − | + | * [[UGDC]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| + | {{#set: common-name=udp-α-d-xylose}} | ||
| + | {{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}} | ||
| + | {{#set: molecular-weight=534.263}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite UDP-D-XYLOSE
- common-name:
- udp-α-d-xylose
- smiles:
- c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
- inchi-key:
- dqqdlyvhotzlor-ocimbmbzsa-l
- molecular-weight:
- 534.263
