Difference between revisions of "UDP-D-XYLOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] ==
+
== Metabolite PARAOXON ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** paraoxon
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.61 ec-2.1.1.61]
+
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-5AminoMe-2-ThioUrdines]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-5MeAminoMe-2-ThioU]][c]
+
** wymsbxtxohuigt-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13939]]
+
** 275.197
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-8746]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-7892]], tRNA-uridine 2-thiolation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7892 PWY-7892]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
{{#set: common-name=paraoxon}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=275.197}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19570 19570]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00601 R00601]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/Q9PJ66 Q9PJ66]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.1.1.61}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:37, 18 December 2020

Metabolite PARAOXON

  • common-name:
    • paraoxon
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
  • inchi-key:
    • wymsbxtxohuigt-uhfffaoysa-n
  • molecular-weight:
    • 275.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP-D-XYLOSE&oldid=48512"