Difference between revisions of "UDP-D-XYLOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite UDP-D-XYLOSE == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5144 RXN0-5144] ==
+
== Metabolite UDP-D-XYLOSE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** udp-α-d-xylose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.1.1.61 ec-2.1.1.61]
+
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-5AminoMe-2-ThioUrdines]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-5MeAminoMe-2-ThioU]][c]
+
** dqqdlyvhotzlor-ocimbmbzsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ13939]]
+
** 534.263
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.4.2.26-RXN]]
−
== Pathway(s) ==
+
* [[2.4.2.38-RXN]]
−
* [[PWY-7892]], tRNA-uridine 2-thiolation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7892 PWY-7892]
+
* [[2.7.7.11-RXN]]
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-9104]]
−
== Reconstruction information  ==
+
* [[UA4E]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[2.7.7.11-RXN]]
−
* RHEA:
+
* [[UA4E]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19570 19570]
+
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
−
* LIGAND-RXN:
+
* [[UGDC]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00601 R00601]
+
== Reaction(s) of unknown directionality ==
−
* UNIPROT:
+
{{#set: common-name=udp-α-d-xylose}}
−
** [http://www.uniprot.org/uniprot/Q9PJ66 Q9PJ66]
+
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
−
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=534.263}}
−
{{#set: ec-number=ec-2.1.1.61}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite UDP-D-XYLOSE

  • common-name:
    • udp-α-d-xylose
  • smiles:
    • c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
  • inchi-key:
    • dqqdlyvhotzlor-ocimbmbzsa-l
  • molecular-weight:
    • 534.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP-D-XYLOSE&oldid=139696"