Difference between revisions of "UDP-GLUCURONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19708 == * transcription-direction: ** negative * right-end-position: ** 65446 * left-end-position: ** 64661 * centisome-position: ** 29.089102...")
 
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19708 ==
+
== Metabolite UDP-GLUCURONATE ==
* transcription-direction:
+
* common-name:
** negative
+
** udp-α-d-glucuronate
* right-end-position:
+
* smiles:
** 65446
+
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
* left-end-position:
+
* inchi-key:
** 64661
+
** hdyanyhvcapmjv-lxqifkjmsa-k
* centisome-position:
+
* molecular-weight:
** 29.089102   
+
** 577.265
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[2.4.1.212-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
* [[2.4.1.225-RXN]]
** Category: [[annotation]]
+
* [[2.7.7.44-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-10606]]
{{#set: transcription-direction=negative}}
+
* [[RXN-10607]]
{{#set: right-end-position=65446}}
+
* [[RXN-10608]]
{{#set: left-end-position=64661}}
+
* [[RXN-10609]]
{{#set: centisome-position=29.089102    }}
+
* [[RXN-10616]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-10617]]
{{#set: nb reaction associated=1}}
+
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-9000]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UGDC]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.7.7.44-RXN]]
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 +
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 +
{{#set: molecular-weight=577.265}}

Latest revision as of 11:11, 18 March 2021

Metabolite UDP-GLUCURONATE

  • common-name:
    • udp-α-d-glucuronate
  • smiles:
    • c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • hdyanyhvcapmjv-lxqifkjmsa-k
  • molecular-weight:
    • 577.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality