Difference between revisions of "UDP-L-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10622 == * transcription-direction: ** positive * right-end-position: ** 337323 * left-end-position: ** 322818 * centisome-position: ** 83.3903...")
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10622 ==
+
== Metabolite UDP-L-RHAMNOSE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** udp-β-l-rhamnose
−
* right-end-position:
+
* smiles:
−
** 337323
+
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
−
* left-end-position:
+
* inchi-key:
−
** 322818
+
** drdcjeizvlvwnc-slbwpepysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 83.3903   
+
** 548.29
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10740]]
−
* [[2.7.7.60-RXN]]
+
* [[RXN-5482]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=udp-β-l-rhamnose}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=548.29}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7560]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[NONMEVIPP-PWY]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=337323}}
 
−
{{#set: left-end-position=322818}}
 
−
{{#set: centisome-position=83.3903    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite UDP-L-RHAMNOSE

  • common-name:
    • udp-β-l-rhamnose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • drdcjeizvlvwnc-slbwpepysa-l
  • molecular-weight:
    • 548.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP-L-RHAMNOSE&oldid=136936"