Difference between revisions of "UDP-L-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21782 == * transcription-direction: ** negative * right-end-position: ** 80450 * left-end-position: ** 47546 * centisome-position: ** 25.505049...")
 
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-]...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21782 ==
+
== Metabolite UDP-L-RHAMNOSE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** udp-β-l-rhamnose
−
* right-end-position:
+
* smiles:
−
** 80450
+
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
−
* left-end-position:
+
* inchi-key:
−
** 47546
+
** drdcjeizvlvwnc-slbwpepysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 25.505049   
+
** 548.29
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10740]]
−
* [[RXN-8988]]
+
* [[RXN-5482]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=udp-β-l-rhamnose}}
−
* [[SUCCCOASYN-RXN]]
+
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=548.29}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY-5749]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[P42-PWY]]
 
−
** '''5''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5392]]
 
−
** '''6''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-5690]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY66-398]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-6969]]
 
−
** '''10''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-5913]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-5538]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5537]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[TCA]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[P23-PWY]]
 
−
** '''9''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7384]]
 
−
** '''6''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6728]]
 
−
** '''11''' reactions found over '''19''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=80450}}
 
−
{{#set: left-end-position=47546}}
 
−
{{#set: centisome-position=25.505049    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=13}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite UDP-L-RHAMNOSE

  • common-name:
    • udp-β-l-rhamnose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • drdcjeizvlvwnc-slbwpepysa-l
  • molecular-weight:
    • 548.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP-L-RHAMNOSE&oldid=136936"