Difference between revisions of "UDP-L-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...")
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-]...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7409 ==
+
== Metabolite UDP-L-RHAMNOSE ==
 
* common-name:
 
* common-name:
** β-cryptoxanthin
+
** udp-β-l-rhamnose
 
* smiles:
 
* smiles:
** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
+
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
 
* inchi-key:
 
* inchi-key:
** dmaslkhvqrhnes-fkkupvfpsa-n
+
** drdcjeizvlvwnc-slbwpepysa-l
 
* molecular-weight:
 
* molecular-weight:
** 552.882
+
** 548.29
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8026]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8025]]
+
* [[RXN-10740]]
 +
* [[RXN-5482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-cryptoxanthin}}
+
{{#set: common-name=udp-β-l-rhamnose}}
{{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}}
+
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
{{#set: molecular-weight=552.882}}
+
{{#set: molecular-weight=548.29}}

Latest revision as of 11:11, 18 March 2021

Metabolite UDP-L-RHAMNOSE

  • common-name:
    • udp-β-l-rhamnose
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • drdcjeizvlvwnc-slbwpepysa-l
  • molecular-weight:
    • 548.29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality