Difference between revisions of "UDP-L-RHAMNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13694 == * common-name: ** 24-hydroxy-3-oxocholest-4-en-26-oyl-coa * smiles: ** cc(ccc(o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-7409 == * common-name: ** β-cryptoxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13694 ==
+
== Metabolite CPD-7409 ==
 
* common-name:
 
* common-name:
** 24-hydroxy-3-oxocholest-4-en-26-oyl-coa
+
** β-cryptoxanthin
 
* smiles:
 
* smiles:
** cc(ccc(o)c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c)[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
+
** cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
 
* inchi-key:
 
* inchi-key:
** lpapcixieiqrqa-oqrfgcrrsa-j
+
** dmaslkhvqrhnes-fkkupvfpsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1176.114
+
** 552.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12705]]
+
* [[RXN-8026]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8025]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=24-hydroxy-3-oxocholest-4-en-26-oyl-coa}}
+
{{#set: common-name=β-cryptoxanthin}}
{{#set: inchi-key=inchikey=lpapcixieiqrqa-oqrfgcrrsa-j}}
+
{{#set: inchi-key=inchikey=dmaslkhvqrhnes-fkkupvfpsa-n}}
{{#set: molecular-weight=1176.114}}
+
{{#set: molecular-weight=552.882}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-7409

  • common-name:
    • β-cryptoxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c=cc1(c(c)(c)cc(cc=1c)o))c)c)c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c
  • inchi-key:
    • dmaslkhvqrhnes-fkkupvfpsa-n
  • molecular-weight:
    • 552.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality