Difference between revisions of "UDP-N-ACETYL-D-GLUCOSAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14598 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.25.1-RXN ** Catego...")
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * smiles: ** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(n...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14598 ==
+
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** udp-n-acetyl-α-d-glucosamine
−
== Reaction(s) associated ==
+
* smiles:
−
* [[3.4.25.1-RXN]]
+
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
−
** Category: [[orthology]]
+
* inchi-key:
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** lftytuazoprmmi-cfrasdgpsa-l
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
−
{{#set: nb reaction associated=1}}
+
** 605.342
 +
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.101-RXN]]
 +
* [[2.4.1.141-RXN]]
 +
* [[2.4.1.145-RXN]]
 +
* [[2.4.1.155-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.7.8.15-RXN]]
 +
* [[2.7.8.17-RXN]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-15205]]
 +
* [[RXN-6501]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
 +
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
 +
{{#set: molecular-weight=605.342}}

Latest revision as of 11:15, 18 March 2021

Metabolite UDP-N-ACETYL-D-GLUCOSAMINE

  • common-name:
    • udp-n-acetyl-α-d-glucosamine
  • smiles:
    • cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
  • inchi-key:
    • lftytuazoprmmi-cfrasdgpsa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=UDP-N-ACETYL-D-GLUCOSAMINE&oldid=138531"