Difference between revisions of "UDP-N-ACETYL-D-GLUCOSAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIMETHYL-GLYCINE == * common-name: ** n,n-dimethylglycine * smiles: ** c[n+](cc([o-])=o)c * inchi-key: ** ffdgpvchzbvarc-uhfffaoysa-n * m...")
(Created page with "Category:metabolite == Metabolite UDP-N-ACETYL-D-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine * smiles: ** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(n...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIMETHYL-GLYCINE ==
+
== Metabolite UDP-N-ACETYL-D-GLUCOSAMINE ==
 
* common-name:
 
* common-name:
** n,n-dimethylglycine
+
** udp-n-acetyl-α-d-glucosamine
 
* smiles:
 
* smiles:
** c[n+](cc([o-])=o)c
+
** cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
 
* inchi-key:
 
* inchi-key:
** ffdgpvchzbvarc-uhfffaoysa-n
+
** lftytuazoprmmi-cfrasdgpsa-l
 
* molecular-weight:
 
* molecular-weight:
** 103.121
+
** 605.342
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
+
* [[2.4.1.101-RXN]]
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
+
* [[2.4.1.141-RXN]]
* [[RXN-9680]]
+
* [[2.4.1.145-RXN]]
 +
* [[2.4.1.155-RXN]]
 +
* [[2.4.1.198-RXN]]
 +
* [[2.4.1.201-RXN]]
 +
* [[2.4.1.223-RXN]]
 +
* [[2.4.1.224-RXN]]
 +
* [[2.4.1.229-RXN]]
 +
* [[2.4.1.94-RXN]]
 +
* [[2.7.8.15-RXN]]
 +
* [[2.7.8.17-RXN]]
 +
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-15205]]
 +
* [[RXN-6501]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.5-RXN]]
+
* [[2.4.1.198-RXN]]
* [[RXN-13404]]
+
* [[2.4.1.229-RXN]]
* [[RXN-4181-CPD-4101/DIMETHYL-GLYCINE//EPISTEROL/BETAINE.45.]]
+
* [[2.4.1.94-RXN]]
* [[RXN-4208-CPD-4124/DIMETHYL-GLYCINE//CPD-4125/BETAINE.44.]]
+
* [[NAG1P-URIDYLTRANS-RXN]]
* [[RXN-9679]]
+
* [[RXN-11627]]
 +
* [[RXN-11889]]
 +
* [[RXN-11890]]
 +
* [[RXN-7873]]
 +
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n,n-dimethylglycine}}
+
{{#set: common-name=udp-n-acetyl-α-d-glucosamine}}
{{#set: inchi-key=inchikey=ffdgpvchzbvarc-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lftytuazoprmmi-cfrasdgpsa-l}}
{{#set: molecular-weight=103.121}}
+
{{#set: molecular-weight=605.342}}

Latest revision as of 11:15, 18 March 2021

Metabolite UDP-N-ACETYL-D-GLUCOSAMINE

  • common-name:
    • udp-n-acetyl-α-d-glucosamine
  • smiles:
    • cc(=o)nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co)
  • inchi-key:
    • lftytuazoprmmi-cfrasdgpsa-l
  • molecular-weight:
    • 605.342

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality