Difference between revisions of "UDP-OHMYR-GLUCOSAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-309 == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] * inchi-key: ** imxsccduafeioe-ritpcoansa...") |
(Created page with "Category:metabolite == Metabolite mature-tRNA == * common-name: ** mature trna == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite mature-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** mature trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[1. | + | * [[3.1.26.11-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=mature trna}} |
| − | |||
| − | |||
Revision as of 11:14, 15 January 2021
Contents
Metabolite mature-tRNA
- common-name:
- mature trna
