Difference between revisions of "UDP-OHMYR-GLUCOSAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine * smiles: ** cc1(n=c(n)c(=cn=...")
(Created page with "Category:metabolite == Metabolite UDP-OHMYR-GLUCOSAMINE == * common-name: ** udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine * smiles: ** cccccccccccc(cc(oc3(c(c(op(=o)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
+
== Metabolite UDP-OHMYR-GLUCOSAMINE ==
 
* common-name:
 
* common-name:
** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
+
** udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine
 
* smiles:
 
* smiles:
** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
+
** cccccccccccc(cc(oc3(c(c(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))oc(c3o)co)[n+]))=o)o
 
* inchi-key:
 
* inchi-key:
** agqjqcfepuvxnk-uhfffaoysa-k
+
** zfpnnoxcedqjqs-ssvoxrmnsa-m
 
* molecular-weight:
 
* molecular-weight:
** 296.093
+
** 790.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12610]]
+
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
* [[RXN-12611]]
 
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRIMSYN3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}}
+
{{#set: common-name=udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine}}
{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=zfpnnoxcedqjqs-ssvoxrmnsa-m}}
{{#set: molecular-weight=296.093}}
+
{{#set: molecular-weight=790.671}}

Latest revision as of 11:12, 18 March 2021

Metabolite UDP-OHMYR-GLUCOSAMINE

  • common-name:
    • udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine
  • smiles:
    • cccccccccccc(cc(oc3(c(c(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))oc(c3o)co)[n+]))=o)o
  • inchi-key:
    • zfpnnoxcedqjqs-ssvoxrmnsa-m
  • molecular-weight:
    • 790.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality