Difference between revisions of "UDP-OHMYR-GLUCOSAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-309 == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] * inchi-key: ** imxsccduafeioe-ritpcoansa...") |
(Created page with "Category:metabolite == Metabolite UDP-OHMYR-GLUCOSAMINE == * common-name: ** udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine * smiles: ** cccccccccccc(cc(oc3(c(c(op(=o)...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UDP-OHMYR-GLUCOSAMINE == |
* common-name: | * common-name: | ||
− | ** d- | + | ** udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine |
* smiles: | * smiles: | ||
− | ** cc(c([o-])=o)[ | + | ** cccccccccccc(cc(oc3(c(c(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))oc(c3o)co)[n+]))=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zfpnnoxcedqjqs-ssvoxrmnsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 790.671 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=d- | + | {{#set: common-name=udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zfpnnoxcedqjqs-ssvoxrmnsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=790.671}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite UDP-OHMYR-GLUCOSAMINE
- common-name:
- udp-3-o-(3-hydroxymyristoyl)-α-d-glucosamine
- smiles:
- cccccccccccc(cc(oc3(c(c(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))oc(c3o)co)[n+]))=o)o
- inchi-key:
- zfpnnoxcedqjqs-ssvoxrmnsa-m
- molecular-weight:
- 790.671