Difference between revisions of "UDP-OHMYR-GLUCOSAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-semialdehyde == * common-name: ** a [2-aminoadipate carrier protein]-l-glutamate 5-semialdehyde == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == * common-name: ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine * smiles: ** cc1(n=c(n)c(=cn=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine |
| + | * smiles: | ||
| + | ** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** agqjqcfepuvxnk-uhfffaoysa-k | ||
| + | * molecular-weight: | ||
| + | ** 296.093 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12610]] |
| + | * [[RXN-12611]] | ||
| + | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PYRIMSYN3-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}} |
| + | {{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=296.093}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP
- common-name:
- 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
- smiles:
- cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
- inchi-key:
- agqjqcfepuvxnk-uhfffaoysa-k
- molecular-weight:
- 296.093
