Difference between revisions of "UDP-SULFOQUINOVOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11388 == * transcription-direction: ** positive * right-end-position: ** 275623 * left-end-position: ** 255883 * centisome-position: ** 68.6225...") |
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite UDP-SULFOQUINOVOSE == |
− | * | + | * common-name: |
− | ** | + | ** udp-α-d-sulfoquinovopyranose |
− | * | + | * smiles: |
− | ** | + | ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)) |
− | * | + | * inchi-key: |
− | ** | + | ** fqancgqcbcusmi-jzmiexbbsa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 627.34 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-1223]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=udp-α-d-sulfoquinovopyranose}} | |
− | + | {{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}} | |
− | + | {{#set: molecular-weight=627.34}} | |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite UDP-SULFOQUINOVOSE
- common-name:
- udp-α-d-sulfoquinovopyranose
- smiles:
- c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
- inchi-key:
- fqancgqcbcusmi-jzmiexbbsa-k
- molecular-weight:
- 627.34