Difference between revisions of "UDP-SULFOQUINOVOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11388 == * transcription-direction: ** positive * right-end-position: ** 275623 * left-end-position: ** 255883 * centisome-position: ** 68.6225...")
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * smiles: ** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11388 ==
+
== Metabolite UDP-SULFOQUINOVOSE ==
* transcription-direction:
+
* common-name:
** positive
+
** udp-α-d-sulfoquinovopyranose
* right-end-position:
+
* smiles:
** 275623
+
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
* left-end-position:
+
* inchi-key:
** 255883
+
** fqancgqcbcusmi-jzmiexbbsa-k
* centisome-position:
+
* molecular-weight:
** 68.6225   
+
** 627.34
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-1223]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
** Category: [[orthology]]
+
{{#set: molecular-weight=627.34}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=275623}}
 
{{#set: left-end-position=255883}}
 
{{#set: centisome-position=68.6225    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite UDP-SULFOQUINOVOSE

  • common-name:
    • udp-α-d-sulfoquinovopyranose
  • smiles:
    • c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
  • inchi-key:
    • fqancgqcbcusmi-jzmiexbbsa-k
  • molecular-weight:
    • 627.34

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality