Difference between revisions of "UMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10707 RXN-10707] == * direction: ** left-to-right * common-name: ** fatty-acyl coenzyme a oxida...")
(Created page with "Category:metabolite == Metabolite 2-KETOGLUTARATE == * common-name: ** 2-oxoglutarate * smiles: ** c(cc([o-])=o)c(=o)c([o-])=o * inchi-key: ** kpgxrsrhynqifn-uhfffaoysa-l...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10707 RXN-10707] ==
+
== Metabolite 2-KETOGLUTARATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** fatty-acyl coenzyme a oxidase
+
** 2-oxoglutarate
** acyl-coa oxidase
+
* smiles:
* ec-number:
+
** c(cc([o-])=o)c(=o)c([o-])=o
** [http://enzyme.expasy.org/EC/1.3.3.6 ec-1.3.3.6]
+
* inchi-key:
== Reaction formula ==
+
** kpgxrsrhynqifn-uhfffaoysa-l
* 1 [[CPD-11525]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-11526]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 144.084
* Gene: [[SJ13468]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[1.14.11.1-RXN]]
** Category: [[orthology]]
+
* [[1.14.11.18-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.14.11.2-RXN]]
* Gene: [[SJ19669]]
+
* [[1.5.1.19-RXN]]
** Category: [[orthology]]
+
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2.5.1.64-RXN]]
* Gene: [[SJ07451]]
+
* [[2.6.1.57-RXN]]
** Category: [[annotation]]
+
* [[2.6.1.7-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2OXOGLUTARATEDEH-RXN]]
** Category: [[orthology]]
+
* [[2OXOGLUTDECARB-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
* Gene: [[SJ03090]]
+
* [[ACETYLORNTRANSAM-RXN]]
** Category: [[annotation]]
+
* [[AKGCITtm]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AKGDHmi]]
* Gene: [[SJ07452]]
+
* [[ALANINE-AMINOTRANSFERASE-RXN]]
** Category: [[annotation]]
+
* [[ASPAMINOTRANS-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
== Pathway(s) ==
+
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
+
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
** '''16''' reactions found over '''19''' reactions in the full pathway
+
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
== Reconstruction information  ==
+
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GABATRANSAM-RXN]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
== External links  ==
+
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
{{#set: direction=left-to-right}}
+
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
{{#set: common-name=fatty-acyl coenzyme a oxidase|acyl-coa oxidase}}
+
* [[GLUTAMATESYN-RXN]]
{{#set: ec-number=ec-1.3.3.6}}
+
* [[GLUTDEHYD-RXN]]
{{#set: nb gene associated=5}}
+
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
{{#set: nb pathway associated=1}}
+
* [[HISTAMINOTRANS-RXN]]
{{#set: reconstruction category=annotation|orthology}}
+
* [[ISOCITDEH-RXN]]
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
* [[KETOGLUTREDUCT-RXN]]
{{#set: reconstruction comment=n.a}}
+
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
+
* [[OAAAKGtm]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-113]]
 +
* [[RXN-11320]]
 +
* [[RXN-11321]]
 +
* [[RXN-115]]
 +
* [[RXN-11737]]
 +
* [[RXN-12353]]
 +
* [[RXN-13186]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-15007]]
 +
* [[RXN-16701]]
 +
* [[RXN-171]]
 +
* [[RXN-17811]]
 +
* [[RXN-2901]]
 +
* [[RXN-527]]
 +
* [[RXN-602]]
 +
* [[RXN-6550]]
 +
* [[RXN-7648]]
 +
* [[RXN-7737]]
 +
* [[RXN-7775]]
 +
* [[RXN-7922]]
 +
* [[RXN-8450]]
 +
* [[RXN-8642]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN0-1863]]
 +
* [[RXN0-7090]]
 +
* [[RXN0-984]]
 +
* [[RXN0-985]]
 +
* [[RXN0-986]]
 +
* [[RXN1F-162]]
 +
* [[RXN1F-163]]
 +
* [[RXN1F-165]]
 +
* [[RXN1F-167]]
 +
* [[RXN1F-168]]
 +
* [[RXN1F-93]]
 +
* [[RXN490-3641]]
 +
* [[RXN66-470]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 +
* [[2.6.1.57-RXN]]
 +
* [[2.6.1.7-RXN]]
 +
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[AKGCITtm]]
 +
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 +
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 +
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 +
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[GABATRANSAM-RXN]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[HISTAMINOTRANS-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[KETOGLUTREDUCT-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATE-TRANSAMINE-RXN]]
 +
* [[PSERTRANSAM-RXN]]
 +
* [[PSERTRANSAMPYR-RXN]]
 +
* [[RXN-10721]]
 +
* [[RXN-10814]]
 +
* [[RXN-11737]]
 +
* [[RXN-12878]]
 +
* [[RXN-13697]]
 +
* [[RXN-13698]]
 +
* [[RXN-14147]]
 +
* [[RXN-14932]]
 +
* [[RXN-15007]]
 +
* [[RXN-16701]]
 +
* [[RXN-17811]]
 +
* [[RXN-2901]]
 +
* [[RXN-7737]]
 +
* [[RXN-8642]]
 +
* [[RXN0-1863]]
 +
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 +
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=2-oxoglutarate}}
 +
{{#set: inchi-key=inchikey=kpgxrsrhynqifn-uhfffaoysa-l}}
 +
{{#set: molecular-weight=144.084}}

Revision as of 20:37, 18 December 2020

Metabolite 2-KETOGLUTARATE

  • common-name:
    • 2-oxoglutarate
  • smiles:
    • c(cc([o-])=o)c(=o)c([o-])=o
  • inchi-key:
    • kpgxrsrhynqifn-uhfffaoysa-l
  • molecular-weight:
    • 144.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality