Difference between revisions of "UMP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AAL_LPAREN_fum_RPAREN_ AAL_LPAREN_fum_RPAREN_] == * direction: ** left-to-right * common-name: ** n...")
 
(Created page with "Category:metabolite == Metabolite UMP == * common-name: ** ump * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** djjcxfvjdgthfx-xvfcmesi...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AAL_LPAREN_fum_RPAREN_ AAL_LPAREN_fum_RPAREN_] ==
+
== Metabolite UMP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** n6-(1,2-dicarboxyethyl)amp amp-lyase (fumarate-forming)
+
** ump
== Reaction formula ==
+
* smiles:
* 1.0 [[ADENYLOSUCC]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[FUM]][c]
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ06544]]
+
** djjcxfvjdgthfx-xvfcmesisa-l
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 322.168
== Pathway(s)  ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[RXN-12002]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14025]]
== External links  ==
+
* [[RXN-8975]]
{{#set: direction=left-to-right}}
+
* [[UDPGALth]]
{{#set: common-name=n6-(1,2-dicarboxyethyl)amp amp-lyase (fumarate-forming)}}
+
* [[UMPP]]
{{#set: nb gene associated=1}}
+
== Reaction(s) known to produce the compound ==
{{#set: nb pathway associated=0}}
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
{{#set: reconstruction category=orthology}}
+
* [[2.7.8.15-RXN]]
{{#set: reconstruction tool=pantograph}}
+
* [[2.7.8.17-RXN]]
{{#set: reconstruction comment=n.a}}
+
* [[AUPT]]
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[DATUP]]
 +
* [[DCTUP]]
 +
* [[DGTUP]]
 +
* [[DTTUP]]
 +
* [[DUTUP]]
 +
* [[GTUP]]
 +
* [[ITUP]]
 +
* [[OROTPDECARB-RXN]]
 +
* [[ORPDC]]
 +
* [[PHOSNACMURPENTATRANS-RXN]]
 +
* [[RXN-11347]]
 +
* [[RXN-12197]]
 +
* [[RXN-12199]]
 +
* [[RXN-14139]]
 +
* [[RXN-8975]]
 +
* [[UDPGALth]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[URKI-RXN]]
 +
* [[UTPPH]]
 +
* [[UTUP]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=ump}}
 +
{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}
 +
{{#set: molecular-weight=322.168}}

Latest revision as of 11:17, 18 March 2021

Metabolite UMP

  • common-name:
    • ump
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • djjcxfvjdgthfx-xvfcmesisa-l
  • molecular-weight:
    • 322.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality