Difference between revisions of "UNDECAPRENYL-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...")
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYS-GLY ==
+
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** l-cysteinyl-glycine
+
** di-trans,octa-cis-undecaprenyl diphosphate
 
* smiles:
 
* smiles:
** c(c([o-])=o)nc(c(cs)[n+])=o
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
* inchi-key:
** zukpvrwzdmrieo-vkhmyheasa-n
+
** ntxgvhccxvhycl-ntdveaecsa-k
 
* molecular-weight:
 
* molecular-weight:
** 178.206
+
** 924.251
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6622]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12618]]
+
* [[RXN-8999]]
* [[RXN-18092]]
 
* [[RXN-6601]]
 
* [[RXN-9157]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteinyl-glycine}}
+
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}
{{#set: molecular-weight=178.206}}
+
{{#set: molecular-weight=924.251}}

Latest revision as of 11:14, 18 March 2021

Metabolite UNDECAPRENYL-DIPHOSPHATE

  • common-name:
    • di-trans,octa-cis-undecaprenyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
  • inchi-key:
    • ntxgvhccxvhycl-ntdveaecsa-k
  • molecular-weight:
    • 924.251

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality