Difference between revisions of "UNDECAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-acetyl-D-glucosamine-asparagine == * common-name: ** n-acetyl-d-glucosamine-asparagine == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CYS-GLY == |
* common-name: | * common-name: | ||
− | ** n- | + | ** l-cysteinyl-glycine |
+ | * smiles: | ||
+ | ** c(c([o-])=o)nc(c(cs)[n+])=o | ||
+ | * inchi-key: | ||
+ | ** zukpvrwzdmrieo-vkhmyheasa-n | ||
+ | * molecular-weight: | ||
+ | ** 178.206 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-6622]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12618]] |
+ | * [[RXN-18092]] | ||
+ | * [[RXN-6601]] | ||
+ | * [[RXN-9157]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-cysteinyl-glycine}} |
+ | {{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}} | ||
+ | {{#set: molecular-weight=178.206}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CYS-GLY
- common-name:
- l-cysteinyl-glycine
- smiles:
- c(c([o-])=o)nc(c(cs)[n+])=o
- inchi-key:
- zukpvrwzdmrieo-vkhmyheasa-n
- molecular-weight:
- 178.206