Difference between revisions of "UNDECAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15041 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DNA-DIRECTED-DNA-POLYMER...") |
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UNDECAPRENYL-DIPHOSPHATE == |
| − | == | + | * common-name: |
| − | + | ** di-trans,octa-cis-undecaprenyl diphosphate | |
| − | == | + | * smiles: |
| − | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c | |
| − | + | * inchi-key: | |
| − | + | ** ntxgvhccxvhycl-ntdveaecsa-k | |
| − | * | + | * molecular-weight: |
| − | + | ** 924.251 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8999]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}} | |
| − | + | {{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}} | |
| − | + | {{#set: molecular-weight=924.251}} | |
| − | |||
| − | ** | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite UNDECAPRENYL-DIPHOSPHATE
- common-name:
- di-trans,octa-cis-undecaprenyl diphosphate
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
- inchi-key:
- ntxgvhccxvhycl-ntdveaecsa-k
- molecular-weight:
- 924.251
