Difference between revisions of "URACIL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
(Created page with "Category:metabolite == Metabolite URACIL == * common-name: ** uracil * smiles: ** c1(=cc(nc(=o)n1)=o) * inchi-key: ** isakrjdgnuqoic-uhfffaoysa-n * molecular-weight: ** 11...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15677 ==
+
== Metabolite URACIL ==
 
* common-name:
 
* common-name:
** 4-trans-undecenoyl-coa
+
** uracil
 
* smiles:
 
* smiles:
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(=cc(nc(=o)n1)=o)
 
* inchi-key:
 
* inchi-key:
** afmmiiqkxqnedn-dupkwvsksa-j
+
** isakrjdgnuqoic-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 929.765
+
** 112.088
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14789]]
+
* [[RXN0-5398]]
 +
* [[URA-PHOSPH-RXN]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14788]]
+
* [[RXN0-2584]]
 +
* [[RXN0-5398]]
 +
* [[URA-PHOSPH-RXN]]
 +
* [[URIDINE-NUCLEOSIDASE-RXN]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-trans-undecenoyl-coa}}
+
{{#set: common-name=uracil}}
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}}
+
{{#set: inchi-key=inchikey=isakrjdgnuqoic-uhfffaoysa-n}}
{{#set: molecular-weight=929.765}}
+
{{#set: molecular-weight=112.088}}

Latest revision as of 11:16, 18 March 2021

Metabolite URACIL

  • common-name:
    • uracil
  • smiles:
    • c1(=cc(nc(=o)n1)=o)
  • inchi-key:
    • isakrjdgnuqoic-uhfffaoysa-n
  • molecular-weight:
    • 112.088

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality