Difference between revisions of "URACIL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15668 == * common-name: ** 4-cis-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...") |
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15677 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** 4-trans-undecenoyl-coa |
* smiles: | * smiles: | ||
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
* inchi-key: | * inchi-key: | ||
− | ** afmmiiqkxqnedn- | + | ** afmmiiqkxqnedn-dupkwvsksa-j |
* molecular-weight: | * molecular-weight: | ||
** 929.765 | ** 929.765 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14789]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14788]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=4-trans-undecenoyl-coa}} |
− | {{#set: inchi-key=inchikey=afmmiiqkxqnedn- | + | {{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}} |
{{#set: molecular-weight=929.765}} | {{#set: molecular-weight=929.765}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD-15677
- common-name:
- 4-trans-undecenoyl-coa
- smiles:
- ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- afmmiiqkxqnedn-dupkwvsksa-j
- molecular-weight:
- 929.765